
CAS 100-32-3: Bis(4-nitrophenyl) disulfide
Formula:C12H8N2O4S2
InChI:InChI=1S/C12H8N2O4S2/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h1-8H
InChI key:InChIKey=KWGZRLZJBLEVFZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(SSC2=CC=C(N(=O)=O)C=C2)C=C1
Synonyms:- 1,1'-Disulfanediylbis(4-Nitrobenzene)
- 1,1′-Dithiobis(4-Nitrobenzene)
- 1,2-Bis(4-nitrophenyl)disulfane
- 1-Nitro-4-[(4-nitrophenyl)disulfanyl]benzene
- 4,4-Dinitro diphenyl disulfide
- Bis(4-nitrophenyl) disulfide
- Bis(p-nitrophenyl) disulfide
- Di(4-nitrophenyl) disulfide
- Di(p-nitrophenyl) disulfide
- Disulfide, bis(4-nitrophenyl)
- Disulfide, bis(p-nitrophenyl)
- See more synonyms
Sort by
Found 5 products.
Bis(4-nitrophenyl) Disulfide
CAS:Formula:C12H8N2O4S2Purity:>97.0%(GC)Color and Shape:White to Yellow powder to crystalMolecular weight:308.334,4'-Dinitro diphenyl disulfide
CAS:4,4'-Dinitro diphenyl disulfide is a molecule that has been shown to induce apoptosis in cells. It has been shown to have antibacterial activity against a number of Gram-positive and Gram-negative bacteria. The mechanism of action of 4,4'-Dinitro diphenyl disulfide is not yet clear but there are several theories as to how it may work. One theory is that the molecule can react with chloride ions on the bacterial cell surface, which leads to the formation of hydrogen chloride gas. This gas interacts with nitric oxide or hydroxyl radicals, leading to the activation of the molecule's antifungal properties. Another theory is that 4,4'-Dinitro diphenyl disulfide binds to the metal surface and penetrates through pores in the cell wall, where it reacts with molecules such as nitro groups or chlorides present inside the cell. The reaction between these molecules leads to an increase in cellular hydrogen ionsPurity:Min. 95%Disulfide, bis(4-nitrophenyl)
CAS:Formula:C12H8N2O4S2Purity:95%Color and Shape:SolidMolecular weight:308.33291-Nitro-4-[(4-nitrophenyl)dithio]benzene
CAS:Purity:97.0%Color and Shape:Solid, Yellow to tan powderMolecular weight:308.3299865722656Bis(4-nitrophenyl) disulphide
CAS:Bis(4-nitrophenyl) disulphideFormula:C12H8N2O4S2Purity:95% (nmr) (Typical Value in Batch COA)Color and Shape: pale yellow solidMolecular weight:308.33g/mol