![1H-Pyrrolo[3,2-c]pyridin-3-amine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F92514-1h-pyrrolo-32-c-pyridin-3-amine.webp&w=3840&q=75)
CAS 1000342-62-0: 1H-Pyrrolo[3,2-c]pyridin-3-amine
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c8-6-4-10-7-1-2-9-3-5(6)7/h1-4,10H,8H2
InChI key:InChIKey=PVXULIOPYOMGME-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC=NC2)NC1
Synonyms:- 1H-Pyrrolo[3,2-c]pyridin-3-amine
Sort by
Found 2 products.
3-Amino-5-azaindole
CAS:3-Amino-5-azaindole is a heterocyclic organic compound that contains both nitrogen and carbon atoms. It has a molecular formula of C5H7N and can be considered as a derivative of benzene in which one hydrogen has been replaced with an amino group. The nitrogen atom is protonated when 3-amino-5-azaindole is in its ground state, but the electron shift to the nitrogen atom makes it possible for this molecule to exist in an excited state. This transition from the ground state to the excited state can be achieved by heating 3-amino-5-azaindole to high temperatures or exposing it to light. In the excited state, 3-amino-5-azaindole will react with certain quinoline derivatives, forming a new molecule called isoquinolone. The isoquinolones are aromatic heterocycles that have various applications, such as pharmaceuticals and dyes.Formula:C7H7N3Purity:Min. 95%Molecular weight:133.15 g/mol