
CAS 100041-05-2: Flazin
Formula:C17H12N2O4
InChI:InChI=1S/C17H12N2O4/c20-8-9-5-6-14(23-9)16-15-11(7-13(19-16)17(21)22)10-3-1-2-4-12(10)18-15/h1-7,18,20H,8H2,(H,21,22)
InChI key:InChIKey=USBWYUYKHHILLZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=C(N1)C=3OC(CO)=CC3)NC=4C2=CC=CC4
Synonyms:- 9H-Pyrido[3,4-b]indole-3-carboxylic acid, 1-[5-(hydroxymethyl)-2-furanyl]-
- Flazine
- 1-[5-(Hydroxymethyl)-2-furanyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid
- Flazin
Sort by
Found 2 products.
Flazin
CAS:Flazin is a synthetic compound, which is derived from a highly controlled chemical synthesis process with precise purity. It acts as a modulator of specific cellular pathways through targeted interactions with signaling molecules, leading to alterations in cellular function. The primary application of Flazin is in the realm of biomedical research, particularly in the study of intracellular signaling pathways that govern cell proliferation and differentiation. Its ability to modulate these pathways renders it a valuable tool for elucidating complex biological processes and mechanisms at the molecular level. As a research tool, Flazin facilitates the exploration of potential therapeutic targets, aiding in drug discovery and development initiatives. Scientists employ Flazin to gain insights into diseases characterized by dysregulated signaling, offering a platform for preclinical investigations and experimental therapeutics.Formula:C17H12N2O4Purity:Min. 95%Molecular weight:308.29 g/mol9H-Pyrido[3,4-b]indole-3-carboxylic acid, 1-[5-(hydroxymethyl)-2-furanyl]-
CAS:Formula:C17H12N2O4Purity:98%Molecular weight:308.2882