
CAS 1001401-62-2: 2-(2H-1,2,3-Triazol-2-yl)benzoic acid
Formula:C9H7N3O2
InChI:InChI=1S/C9H7N3O2/c13-9(14)7-3-1-2-4-8(7)12-10-5-6-11-12/h1-6H,(H,13,14)
InChI key:InChIKey=UTENUPFWBIFKPW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)N2N=CC=N2
Synonyms:- Benzoic acid, 2-(2H-1,2,3-triazol-2-yl)-
- 2-[1,2,3]Triazol-2-ylbenzoic acid
- 2-(2H-1,2,3-Triazol-2-yl)benzoic acid
Sort by
Found 5 products.
Benzoic acid, 2-(2H-1,2,3-triazol-2-yl)-
CAS:Formula:C9H7N3O2Purity:97%Color and Shape:SolidMolecular weight:189.17082-(2H-1,2,3-Triazol-2-yl)benzoic acid
CAS:2-(2H-1,2,3-Triazol-2-yl)benzoic acid is a functional group that is used in organic synthesis. It can be synthesized from benzoic acid using the Grignard reaction with magnesium and 2-bromopropane. This process requires an excess of magnesium and 2-bromopropane to produce a compound with a high yield. The triazole functional group can be synthesized by iodination or carboxylation followed by hydrogenation. The sequence of reactions for this process is shown below: Step 1: Iodination Step 2: Carboxylation Step 3: HydrogenationFormula:C9H7N3O2Purity:Min. 95%Molecular weight:189.17 g/mol2-(2H-1,2,3-Triazol-2-yl)benzoic acid
CAS:2-(2H-1,2,3-Triazol-2-yl)benzoic acidPurity:98%Molecular weight:189.17g/mol2-(2H-1,2,3-TRIAZOL-2-YL)BENZOIC ACID
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:189.1739959716797