
CAS 100163-16-4: hypecoumine
Formula:C19H11NO6
InChI:InChI=1/C19H11NO6/c21-19-15-10(1-2-12-18(15)25-8-22-12)17(26-19)16-11-6-14-13(23-7-24-14)5-9(11)3-4-20-16/h1-6,17H,7-8H2
SMILES:c1cc2c(c3c1C(c1c4cc5c(cc4ccn1)OCO5)OC3=O)OCO2
Synonyms:- Furo(3,4-e)-1,3-benzodioxol-8(6H)-one, 6-(1,3-dioxolo(4,5-g)isoquinolin-5-yl)-, (+)-
- 6-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)furo[3,4-e][1,3]benzodioxol-8(6H)-one
- Hypecoumine
Sort by
Found 2 products.
Decumbenine C
CAS:Decumbenine C is a naturally occurring alkaloid, which is a compound primarily sourced from the plant species within the family Menispermaceae. It is characterized by its intricate molecular structure, typical of plant-derived alkaloids, which are known for their diverse pharmacological activities. The mode of action of Decumbenine C is hypothesized to involve modulation of neural pathways, possibly acting on neurotransmitter systems, though precise mechanisms remain under investigation. The compound holds interest in scientific research due to its potential neuroactive properties. Researchers are particularly focused on its application in neurological studies, given its potential influence on neural signaling pathways. This makes Decumbenine C a candidate for exploring therapeutic avenues in neurodegenerative diseases and other neurological disorders. The exploration of its pharmacokinetics and bioavailability is vital for understanding its full spectrum of activity and potential clinical uses.Formula:C19H11NO6Purity:Min. 95%Molecular weight:349.3 g/mol