Aminoquinol, identified by the CAS number 10023-54-8, is a chemical compound that belongs to the class of amino derivatives of quinoline. It typically exhibits properties associated with both amino groups and quinoline structures, which can influence its reactivity and biological activity. The compound is characterized by its potential use in various applications, including pharmaceuticals and as a research tool in biochemistry. Aminoquinol may possess antimicrobial and antimalarial properties, making it of interest in medicinal chemistry. Its structure allows for interactions with biological targets, which can lead to diverse pharmacological effects. Additionally, the presence of the amino group can enhance solubility in polar solvents, affecting its bioavailability and distribution in biological systems. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, aminoquinol represents a significant compound in the study of medicinal chemistry and its applications in therapeutic contexts.

Aminoquinol

10023-54-8: Aminoquinol [INN], 7-Chlor-2-(2-chlorstyryl)-4-((4-diethylamino-1-methylbutyl)amino)chinolin, 7-Chloro-2-(o-chlorostyryl)-4-((4-(diethylamino)-1-methylbutyl)amino)quinoline, Aminoquinolum, Unii-Ch1Y88E2Ay, N~4~-{7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl}-N~1~,N~1~-diethylpentane-1,4-diamine

1,4-Pentanediamine, N4-[7-chloro-2-[2-(2-chlorophenyl)ethenyl]-4-quinolinyl]-N1,N1-diethyl-

N4-{7-Chloro-2-[2-(2-chloro-phenyl)-vinyl]-quinolin-4-yl}-N1,N1-diethylpentane-1,4-diamine is a small molecule that inhibits signal pathways by binding to the amine groups on proteins. It has been shown to inhibit the production of proinflammatory cytokines and chemokines in skin cancer cells. N4-(7-chloroquinolin-4-yl)-N1,N1 diethylpentaneamine also blocks the adenosine receptor, which prevents cell proliferation. This drug has been found to be effective for treating diabetic neuropathy. N4-(7 chloroquinolin 4 yl) -N1,N1 diethylpentaneamine is water soluble and structurally related to drugs such as nifedipine. It can be synthesized with an x ray crystal structure and has a red

CAS 10023-54-8: Aminoquinol

1,4-Pentanediamine, N4-[7-chloro-2-[2-(2-chlorophenyl)ethenyl]-4-quinolinyl]-N1,N1-diethyl-

Ref: IN-DA0001B4

N4-{7-Chloro-2-[2-(2-chloro-phenyl)-vinyl]-quinolin-4-yl}-N1,N1-diethyl-pentane-1,4-diamine

Ref: 3D-KAA02354