CAS 1013-69-0: Noreugenin
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3
InChI key:InChIKey=NCUJRUDLFCGVOE-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(O)=CC2O)OC(C)=C1
Synonyms:- 2-Methyl-5,7-dihydroxychromone
- 4H-1-benzopyran-4-one, 5,7-dihydroxy-2-methyl-
- 5,7-Dihydroxy-2-methyl-4H-1-benzopyran-4-one
- 5,7-Dihydroxy-2-methylchromome
- 5,7-Dihydroxy-2-methylchromone
- Chromone, 5,7-dihydroxy-2-methyl-
- Noreugenin
- RonaCare Luremin
Sort by
Found 7 products.
4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-methyl-
CAS:Formula:C10H8O4Purity:99%Color and Shape:SolidMolecular weight:192.1681Noreugenin
CAS:Controlled ProductApplications Noreugenin (CAS# 1013-69-0) is a useful research chemical compound.Formula:C10H8O4Color and Shape:NeatMolecular weight:192.168Noreugenin
CAS:Noreugenin is a flavonoid compound, which is a class of polyphenolic plant secondary metabolites. It is primarily sourced from various plant species, where it functions as part of the plant's natural defense system. Flavonoids like Noreugenin are widely recognized for their antioxidant properties, operating primarily through free radical scavenging and metal ion chelation. Noreugenin modulates cellular signaling pathways, influencing gene expression related to oxidative stress and inflammation. Noreugenin's applications in scientific research are extensive due to its potential therapeutic properties. It is employed in studies exploring oxidative stress-related diseases, including cardiovascular and neurodegenerative disorders. Additionally, its anti-inflammatory action is of interest in research focusing on inflammatory conditions and immune response modulation. Noreugenin's role in regulating cellular mechanisms paves the way for investigations into its potential as a chemopreventive agent. The compound's multi-faceted bioactivity makes it a subject of considerable interest in developing functional foods, nutraceuticals, and novel pharmacological strategies aimed at mitigating chronic disease progression and promoting overall health.Formula:C10H8O4Purity:Min. 95%Color and Shape:Beige PowderMolecular weight:192.17 g/molNoreugenin
CAS:Noreugenin is a new chromone from Hymenocallis littoralis Salisb.Formula:C10H8O4Purity:98.67% - 99.62%Color and Shape:SolidMolecular weight:192.17
