
CAS 10201-71-5: 2-Amino-3-methoxypyridine
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3,(H2,7,8)
SMILES:COc1cccnc1N
Synonyms:- 2-Pyridinamine, 3-Methoxy-
- 3-Methoxypyridin-2-amine
Sort by
Found 4 products.
2-Amino-3-methoxypyridine
CAS:2-Amino-3-methoxypyridine is a reactive compound that has been shown to react with hydrogen gas, water, and acids. It can be used as a ligand for inorganic ions such as copper (Cu), nickel (Ni), and cobalt (Co). 2-Amino-3-methoxypyridine is also reactive with nucleophiles such as thiols, amines, and alcohols. The reactive site of the molecule is the pyridinium nitrogen atom. This compound reacts with protonated water molecules to form an acid complex (RCOOH) and hydrogen bond formation.Formula:C6H8N2OPurity:Min. 95%Molecular weight:124.14 g/molRef: 3D-FA54411
Discontinued product2-Pyridinamine, 3-methoxy-
CAS:Formula:C6H8N2OPurity:98%Color and Shape:SolidMolecular weight:124.14052-Amino-3-methoxypyridine
CAS:2-Amino-3-methoxypyridineFormula:C6H8N2OPurity:0.97Color and Shape: dark brown solidMolecular weight:124.14g/mol