
CAS 102067-92-5: Epitheaflagallin 3-O-gallate
Formula:C27H20O13
InChI:InChI=1S/C27H20O13/c28-12-6-14(29)13-8-20(40-27(38)11-4-15(30)22(34)16(31)5-11)26(39-19(13)7-12)10-1-9-2-18(33)24(36)25(37)21(9)23(35)17(32)3-10/h1-7,20,26,28-31,33-34,36-37H,8H2,(H,32,35)/t20-,26-/m1/s1
InChI key:InChIKey=CMGRMMSVGCHWOK-FQRUVTKNSA-N
SMILES:O(C(=O)C1=CC(O)=C(O)C(O)=C1)[C@H]2[C@H](OC=3C(C2)=C(O)C=C(O)C3)C4=CC=5C(C(=O)C(O)=C4)=C(O)C(O)=C(O)C5
Synonyms:- Epitheaflagallin 3-O-gallate
- Benzoic acid, 3,4,5-trihydroxy-, 3,4-dihydro-5,7-dihydroxy-2-(2,3,4,6-tetrahydroxy-5-oxo-5H-benzocyclohepten-8-yl)-2H-1-benzopyran-3-yl ester, (2R-cis)-
- Benzoic acid, 3,4,5-trihydroxy-, (2R,3R)-3,4-dihydro-5,7-dihydroxy-2-(2,3,4,6-tetrahydroxy-5-oxo-5H-benzocyclohepten-8-yl)-2H-1-benzopyran-3-yl ester
Sort by
Found 4 products.
Epitheaflagallin 3-O-gallate
CAS:Epitheaflagallin 3-O-gallate: potential antiobesity, antiperiodontal agent; inhibits tumor growth by blocking angiogenesis.Formula:C27H20O13Purity:98%Color and Shape:SolidMolecular weight:552.44Epitheaflagallin 3-o-gallate
CAS:Epitheaflagallin 3-O-gallate is a bioactive phenolic compound, which is isolated from specific plant sources, notably from certain types of tea leaves. This compound demonstrates potential health benefits owing to its antioxidant properties, which enable it to neutralize free radicals and reduce oxidative stress within biological systems. The mode of action of Epitheaflagallin 3-O-gallate involves various biochemical pathways, where it effectively scavenges reactive oxygen species and inhibits certain enzymes that catalyze oxidative reactions. Additionally, its gallate moiety plays a crucial role in its interaction with cellular components, enhancing its bioactivity. In scientific applications, Epitheaflagallin 3-O-gallate is extensively studied for its potential in pharmaceutical and nutraceutical formulations. Its antioxidant and anti-inflammatory properties make it a candidate for research in disease prevention and health maintenance, particularly in conditions related to oxidative stress, such as cardiovascular diseases and neurodegenerative disorders. Current studies are also exploring its role in modulating cell signaling pathways, offering insights into its therapeutic potential.Formula:C27H20O13Purity:Min. 95%Molecular weight:552.4 g/mol