
CAS 10256-83-4: TETRA-P-TOLYLSILANE
Formula:C28H28Si
InChI:InChI=1/C28H28Si/c1-21-5-13-25(14-6-21)29(26-15-7-22(2)8-16-26,27-17-9-23(3)10-18-27)28-19-11-24(4)12-20-28/h5-20H,1-4H3
SMILES:Cc1ccc(cc1)[Si](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1
Synonyms:- Benzene, 1,1',1'',1'''-Silanetetrayltetrakis[4-Methyl-
- Tetrakis(4-methylphenyl)silane
Sort by
Found 3 products.
Benzene, 1,1',1'',1'''-silanetetrayltetrakis[4-methyl-
CAS:Formula:C28H28SiPurity:95%Color and Shape:LiquidMolecular weight:392.6074Tetrakis(p-tolyl)silane
CAS:Tetrakis(p-tolyl)silane is a silicon-containing compound that turns yellow when heated. It has a high melting point and is thermally stable. Tetrakis(p-tolyl)silane has been shown to be luminescent, fluorescence, and nitrate-sensitive. The interaction of this molecule with aldehydes also depends on the type of silicon atom it is bonded to. For example, if the silicon atom is bonded to an oxygen atom, then the aldehyde will react with the oxygen atom instead of the silicon atom. Tetrakis(p-tolyl)silane is also soluble in chloroform or dichloromethane and insoluble in water. Finally, tetraphenylmethane can be used as an analogue for tetrakis(p-tolyl)silane.Formula:C28H28SiPurity:Min. 95%Molecular weight:392.6 g/mol