
CAS 102577-03-7: Fengycin
Formula:Unspecified
InChI:InChI=1/C72H110N12O20/c1-6-8-9-10-11-12-13-14-15-16-17-20-48(87)41-58(89)76-51(32-35-59(90)91)65(96)77-50(21-18-37-73)64(95)80-55-40-46-25-29-49(30-26-46)104-72(103)61(42(3)7-2)82-67(98)54(39-45-23-27-47(86)28-24-45)81-66(97)52(31-34-57(74)88)78-69(100)56-22-19-38-84(56)71(102)43(4)75-63(94)53(33-36-60(92)93)79-70(101)62(44(5)85)83-68(55)99/h23-30,42-44,48,50-56,61-62,85-87H,6-22,31-41,73H2,1-5H3,(H2,74,88)(H,75,94)(H,76,89)(H,77,96)(H,78,100)(H,79,101)(H,80,95)(H,81,97)(H,82,98)(H,83,99)(H,90,91)(H,92,93)/t42-,43-,44+,48?,50-,51+,52+,53+,54+,55+,56+,61+,62+/m1/s1
Synonyms:- Fengymycin
- N-(3-hydroxyhexadecanoyl)-L-alpha-glutamyl-N-{(3S,6S,9S,17R,20S,23S,26R,31aS)-3-(3-amino-3-oxopropyl)-9-[(2R)-butan-2-yl]-23-(2-carboxyethyl)-6-(4-hydroxybenzyl)-20-[(1S)-1-hydroxyethyl]-26-methyl-1,4,7,10,18,21,24,27-octaoxo-1,2,3,4,5,6,7,8,9,10,16,17,18,19,20,21,22,23,24,25,26,27,29,30,31,31a-hexacosahydro-12,15-ethenopyrrolo[2,1-l][1,4,7,10,13,16,19,22]oxaheptaazacyclononacosin-17-yl}-D-ornithinamide
- Fengycin
Sort by
Found 3 products.
Fengycin
CAS:Fengycin is a cyclic lipopeptide from Bacillus subtilis acts as a biosurfactant and antifungal. As a fungicide, it has a mode of action that involves the formation of ion channels in the fungal lipid membrane, leading to membrane leakage This activity is negatively correlated to cholesterol levels, and may explain why mammalian cells, with higher cholesterol present, are not sensitive to fengycin.Formula:C72H110N12O20Purity:Min. 90 Area-%Color and Shape:PowderMolecular weight:1,463.71 g/molFengycin A analogue
CAS:Fengycin A analogue is an antifungal lipopeptide, which is a cyclic compound derived from microbial sources, specifically produced by Bacillus subtilis strains. It functions primarily by disrupting the cell membranes of pathogenic fungi, leading to altered membrane permeability and subsequent cell death. The unique structure of fengycin allows it to interact with membrane lipids, compromising membrane integrity and inhibiting fungal growth. The uses and applications of Fengycin A analogue are notable in agricultural settings, where it serves as a biocontrol agent against various fungal pathogens affecting crops. Its role extends to contributing to sustainable agricultural practices by reducing the need for chemical fungicides. Additionally, it is of interest in pharmaceutical research due to its potential therapeutic applications against fungal infections. The compound's specific mode of action and natural origin make it a promising candidate for further investigation in both the development of novel antifungal strategies and the enhancement of plant health.Fengycin
CAS:Fengycin (fengmycin), a cyclic lipopeptide produced by Bacillus subtilis, is a biosurfactant with antifungal and biodegradable properties.Formula:C72H110N12O20Color and Shape:SolidMolecular weight:1463.71