
CAS 102681-52-7: Benzo(3,4)cycloocta(1,2-f)(1,3)benzodioxol-1-ol, 5,6,7,8-tetrahydro-2, 3,13-trimethoxy-6,7-dimethyl-, stereoisomer
Formula:C22H26O6
InChI:InChI=1/C22H26O6/c1-11-6-13-8-15(24-3)20(25-4)19(23)17(13)18-14(7-12(11)2)9-16-21(22(18)26-5)28-10-27-16/h8-9,11-12,23H,6-7,10H2,1-5H3/t11-,12+/m1/s1
Synonyms:- schisanhenol B
- (6R,7S)-2,3,13-trimethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-1-ol
Sort by
Found 4 products.
Schisanhenol B
CAS:Schisanhenol B is a natural product from Schisandra chinensis (Turcz.) Baill.Formula:C22H26O6Purity:98%Color and Shape:SolidMolecular weight:386.44Benzo(3,4)cycloocta(1,2-f)(1,3)benzodioxol-1-ol, 5,6,7,8-tetrahydro-2, 3,13-trimethoxy-6,7-dimethyl-, stereoisomer
CAS:Formula:C22H26O6Purity:98.0%Molecular weight:386.4382Schisanhenol B
CAS:Controlled ProductSchisanhenol B is a bioactive compound that has potent inhibitory activity against the enzyme tyrosinase. Tyrosinase is an enzyme that catalyzes the first step in melanin synthesis and its inhibition leads to decreased melanin production. Schisanhenol B also has been shown to inhibit other enzymes, such as fructosyltransferases, which are involved in the synthesis of polysaccharides and glycoproteins. The structural formula of schisanhenol B is biphenyl. This compound has been found to be effective against human liver cells and in vitro assays, with a reported effective dose of 0.1-0.5 μM.Formula:C22H26O6Purity:Min. 95%Molecular weight:386.4 g/mol