CAS 10314-06-4: 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoyl chloride
Formula:C12H10ClNO3
InChI:InChI=1/C12H10ClNO3/c13-10(15)6-3-7-14-11(16)8-4-1-2-5-9(8)12(14)17/h1-2,4-5H,3,6-7H2
SMILES:c1ccc2c(c1)C(=O)N(CCCC(=O)Cl)C2=O
Synonyms:- 2H-Isoindole-2-butanoyl chloride, 1,3-dihydro-1,3-dioxo-
- 4-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoyl chloride
Sort by
Found 4 products.
4-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoyl chloride
CAS:4-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoyl chloride is a reagent that reacts with dialkyl chlorides to form acyl chlorides. The reaction sequence is an acylation reaction in which the alkyl group of the chloro compound is replaced by the acyl group of 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoyl chloride. This compound can also be used for deprotecting amino compounds and ketones. Friedel-Crafts acylation reactions are a type of chemical reaction in which an organic acid reacts with an aromatic hydrocarbon or heterocycle to form an ester or amide. In this reaction, 4-(1,3-Dioxo-1,3 -dihydro -2HFormula:C12H10ClNO3Purity:Min. 95%Molecular weight:251.67 g/molN-(4-Chloro-4-oxobutyl)phthalimide
CAS:N-(4-Chloro-4-oxobutyl)phthalimideMolecular weight:251.67g/mol1-(2-PhthaliMidobutanoyl)chloride
CAS:Formula:C12H10ClNO3Purity:95%Color and Shape:SolidMolecular weight:251.6657
