
CAS 103430-01-9: 5,7-Dimethoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-20-12-6-4-5-11(7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-10H,1-3H3
InChI key:InChIKey=VXUYWDCUZZMTJC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=CC(OC)=CC=C3)=CC(OC)=C1
Synonyms:- 5,7,3′-Trimethoxyflavone
- 4H-1-Benzopyran-4-one, 5,7-dimethoxy-2-(3-methoxyphenyl)-
- 5,7-Dimethoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one
Sort by
Found 1 products.
5,7,3'-Trimethoxyflavone
CAS:5,7,3'-Trimethoxyflavone is a naturally occurring flavonoid compound, which is primarily sourced from certain plant species. As a member of the flavone category, this compound is characterized by its distinctive chemical structure featuring multiple methoxy groups. It is extracted from plants known for their medicinal properties, where it exists as a minor component contributing to the plant’s bioactive profile. The mode of action of 5,7,3'-Trimethoxyflavone is predominantly associated with its ability to modulate various biochemical pathways. It exerts significant anti-inflammatory effects, potentially through the inhibition of pro-inflammatory cytokine production and modulation of signaling pathways such as NF-kB. Additionally, it may affect oxidative stress responses, contributing to its overall biological activity. In the realm of scientific research, 5,7,3'-Trimethoxyflavone is of considerable interest due to its pharmacological potential. Researchers are investigating its role in the development of new therapeutic agents targeting inflammation-related disorders. Its efficacy in modulating inflammation suggests potential applications in conditions such as arthritis and other inflammatory diseases, making it a subject of ongoing pharmacological studies.Formula:C18H16O5Purity:Min. 95%Molecular weight:312.32 g/mol