
CAS 103438-88-6: 2-Fluoro-3-methoxybenzaldehyde
Formula:C8H7FO2
InChI:InChI=1/C8H7FO2/c1-11-7-4-2-3-6(5-10)8(7)9/h2-5H,1H3
SMILES:COc1cccc(C=O)c1F
Sort by
Found 4 products.
2-Fluoro-3-methoxybenzaldehyde
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:154.139999389648442-Fluoro-3-methoxybenzaldehyde
CAS:Formula:C8H7FO2Purity:98%Color and Shape:SolidMolecular weight:154.13842-Fluoro-3-methoxybenzaldehyde
CAS:2-Fluoro-3-methoxybenzaldehydeFormula:C8H7FO2Purity:99%Color and Shape: light beige to light brown crystalline solidMolecular weight:154.14g/mol2-Fluoro-3-methoxybenzaldehyde
CAS:2-Fluoro-3-methoxybenzaldehyde is a 2-nitrobenzaldehyde derivative. It has been used as an inverting agent in techniques that require nucleophilic reactions with nitro compounds and aldehydes. The thermodynamic equilibrium between the reactants and products can be shifted by adding 2-fluoro-3-methoxybenzaldehyde to the reaction mixture, which causes the formation of diacetate instead of oxime. The use of this chemical allows for shorter reaction times, since it is not necessary to remove water from the reaction mixture. This product also inhibits enzyme catalysis by binding to the active site of enzymes such as diacetyl reductase, which are involved in the oxidation process.Formula:C8H7FO2Purity:Min. 95%Molecular weight:154.14 g/molRef: 3D-FF79682
Discontinued product