CAS 103548-82-9: Huperzine B
Formula:C16H20N2O
InChI:InChI=1S/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16+/m0/s1
InChI key:InChIKey=YYWGABLTRMRUIT-HWWQOWPSSA-N
SMILES:CC=1C[C@]23C4=C(C[C@@]([C@]2(CCCN3)[H])(C1)[H])NC(=O)C=C4
Synonyms:- (4aR,5R,10bR)-2,3,4,4a,5,6-Hexahydro-12-methyl-1H-5,10b-propeno-1,7-phenanthrolin-8(7H)-one
- (4aR,5S,10bR)-12-methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one
- 12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one
- 1H-5,10b-Propeno-1,7-phenanthrolin-8(7H)-one, 2,3,4,4a,5,6-hexahydro-12-methyl-, (4aR,5R,10bR)-
- 1H-5,10b-Propeno-1,7-phenanthrolin-8(7H)-one, 2,3,4,4a,5,6-hexahydro-12-methyl-, [4aR-(4aα,5α,10bα)]-
- 8,15-Didehydro-1,18-dihydro-1-oxolycodine
- Fordimine
- HuperzineB
- Lycodin-1(18H)-one, 8,15-didehydro-
- Huperzine B
Sort by
Found 8 products.
Huperzine B
CAS:Huperzine B is a efficient inhibitor of human brain AChE, it can enhance ognitive and protect neuro, may be potentially new drug candidates for Alzheimer's disease therapy.Formula:C16H20N2OPurity:95%~99%Molecular weight:256.349Huperzine B
CAS:Huperzine B is a natural alkaloid that has been found to have a number of pharmacological effects. It has been shown to inhibit the activity of some enzymes such as phospholipases, cyclooxygenases, and lipoxygenases. Huperzine B also inhibits inflammatory reactions by inhibiting the release of pro-inflammatory cytokines from macrophages and neutrophils. The compound binds to dna duplexes and prevents the DNA from separating. This inhibition causes an increase in intracellular Ca2+ levels, which can lead to cell death by apoptosis or necrosis. Huperzine B is also able to bind iron ions and maintain the homeostasis of this essential metal ion in cells. In addition, huperzine B can decrease bowel disease by reducing inflammation and preventing bacteria from adhering to the intestinal lining. Huperzine B is used as a preparative hplc for purification of proteins andPurity:Min. 95%Huperzine b
CAS:Natural alkaloidFormula:C16H20N2OPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:256.35
