
CAS 103974-74-9: Esculentic acid
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,17-18,20-24,31-33H,8-16H2,1-6H3,(H,34,35)/t17-,18+,20-,21-,22-,23+,24-,26+,27+,28-,29-,30+/m1/s1
InChI key:InChIKey=JXSVIVRDWWRQRT-SVOQGVCWSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CC[C@@H](C)[C@@H]4C)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@@](CO)(C)[C@H](O)[C@H](O)C5)[H])[H]
Synonyms:- (2α,3α,4α)-2,3,23-Trihydroxyurs-12-en-28-oic acid
- 2a,3a,23-Trihydroxyurs-12-en-28-oic acid
- Esculentic acid
- Esculentic acid (Diplazium)
- Urs-12-en-28-oic acid, 2,3,23-trihydroxy-, (2α,3α,4α)-
Sort by
Found 4 products.
Esculentic acid
CAS:Esculentic acid has anti-inflammatory effect, it has protective effects against LPS-induced endotoxic shock may be mediated, at least in part, by regulation theFormula:C30H48O5Purity:98%Color and Shape:SolidMolecular weight:488.7Esculentic acid
CAS:Controlled ProductEsculentic acid is a triterpenoid compound, which is a subclass of terpenoids primarily found in various plant sources, including certain vegetables and medicinal herbs. This compound is synthesized through the mevalonate pathway in plants and is often isolated for research due to its potential pharmacological properties. The mode of action of esculentic acid involves interactions with specific cellular targets, leading to modulations in signaling pathways. This allows it to exhibit a range of biological activities, including anti-inflammatory and antioxidant effects. The exact mechanisms can vary depending on the biological context, such as specific cellular environments and target organs. Esculentic acid is used in scientific research focused on understanding its potential therapeutic benefits. Applications of this compound extend to studies investigating its role in modulating immune responses, inhibiting proliferation of certain cell types, and enhancing cellular protective mechanisms. Its functionalities make it a subject of interest in the development of novel therapeutic agents and preventive interventions in chronic inflammatory diseases and oxidative stress-related conditions. The diverse nature of esculentic acid's biological activities warrants further investigation to explore its full range of applications in biomedical sciences.Formula:C30H48O5Purity:Min. 95%Molecular weight:488.7 g/mol