
CAS 10420-73-2: 6-chloroflavone
Formula:C15H9ClO2
InChI:InChI=1/C15H9ClO2/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9H
SMILES:c1ccc(cc1)c1cc(=O)c2cc(ccc2o1)Cl
Synonyms:- 6-chloro-2-phenyl-4H-chromen-4-one
Sort by
Found 5 products.
6-Chloroflavone
CAS:Formula:C15H9ClO2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:256.696-Chloroflavone
CAS:6-Chloroflavone is a synthetic flavonoid derivative, which is a modified chemical compound originating from naturally occurring flavonoids found in various plants. Structurally, it is characterized by the substitution of a chlorine atom at the 6th position on the flavone backbone. This chemical modification is designed to alter its physicochemical properties and enhance its biological activity. The mode of action of 6-Chloroflavone involves its interaction with various cellular pathways, potentially influencing enzymatic activity, signal transduction, and gene expression. It might exert effects on specific enzymes or receptors, leading to modulation of physiological processes such as inflammation, oxidation, and cell proliferation. 6-Chloroflavone is primarily investigated for its potential pharmacological applications. It is being studied for use in research focusing on cancer, neuroprotection, and anti-inflammatory properties. Its ability to interact with and affect multiple biological pathways makes it a subject of interest in both in vitro and in vivo models for understanding the mechanisms of disease and testing therapeutic hypotheses. Researchers utilize this compound to explore its efficacy and mechanism within complex biological systems, aiming to uncover new therapeutic avenues and gain insights into flavonoid-related activities.Formula:C15H9ClO2Purity:Min. 95%Molecular weight:256.68 g/mol