CAS 104670-74-8: Benzoic acid, 2-amino-3-bromo-, methyl ester
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,10H2,1H3
SMILES:COC(=O)c1cccc(c1N)Br
Synonyms:- Methyl 2-Amino-3-Bromobenzoate
- 2-amino-3-bromo-Benzoic acid methyl ester
Sort by
Found 4 products.
Methyl 2-amino-3-bromobenzoate
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:230.06100463867188Methyl 2-amino-3-bromobenzoate
CAS:Methyl 2-amino-3-bromobenzoate is a high quality, versatile building block that is used as a reagent and intermediate in the synthesis of biologically active compounds. Methyl 2-amino-3-bromobenzoate is a complex compound that has proven useful as an intermediate in the synthesis of various fine chemicals, such as speciality chemicals. The compound also serves as a useful scaffold for the preparation of other compounds, such as research chemicals. Methyl 2-amino-3-bromobenzoate can be used in reactions with other reagents to form new compounds. It is also used to make important reaction components, such as CAS No. 104670-74-8.Formula:C8H8BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:230.06 g/molMethyl 2-amino-3-bromobenzoate
CAS:Methyl 2-amino-3-bromobenzoateFormula:C8H8BrNO2Purity:97+%Color and Shape: light brown solidMolecular weight:230.06g/mol2-Amino-3-bromobenzoic acid methyl ester
CAS:Formula:C8H8BrNO2Purity:98%Color and Shape:SolidMolecular weight:230.0586
