![4-[(2S,3R,4R)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2,6-dimethoxyph…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F254705-4-2s-3r-4r-4-4-hydroxy-3-methoxybenzyl-3-hydroxymethyl-tetrahydrofuran-2-yl-26-dimethoxyphenol.webp&w=3840&q=75)
CAS 105256-12-0: 4-[(2S,3R,4R)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2,6-dimethoxyphenol
Formula:C21H26O7
InChI:InChI=1/C21H26O7/c1-25-17-7-12(4-5-16(17)23)6-14-11-28-21(15(14)10-22)13-8-18(26-2)20(24)19(9-13)27-3/h4-5,7-9,14-15,21-24H,6,10-11H2,1-3H3/t14-,15-,21+/m0/s1
Sort by
Found 4 products.
5'-Methoxylariciresinol
CAS:5'-Methoxylariciresinol is a natural product from Stellera chamaejasme.Formula:C21H26O7Purity:98%Color and Shape:SolidMolecular weight:390.435'-Methoxylariciresinol
CAS:5'-Methoxylariciresinol is a naturally occurring lignan, which is a polyphenolic compound derived from plant sources such as flaxseeds, sesame seeds, and various other dietary plants. This compound is part of the broader class of lignans known for their presence in fiber-rich plants. Its mode of action primarily involves its role as an antioxidant, where it neutralizes free radicals and reduces oxidative stress, potentially influencing various biological pathways related to inflammation and cellular aging. 5'-Methoxylariciresinol has been studied for its potential therapeutic applications, particularly in the fields of oncology and cardiovascular health, due to its ability to modulate hormone-related activities. It is involved in the modulation of estrogenic activities, indicative of potential benefit in hormone-sensitive conditions. Furthermore, its antioxidant properties render it a candidate for interventions aimed at reducing cell damage and supporting overall cellular health. Ongoing research is investigating its broader applications, including its role in modulating immune responses and potentially serving as a chemopreventive agent in various cancers.Formula:C21H26O7Purity:Min. 95%Molecular weight:390.4 g/mol3-Furanmethanol,tetrahydro-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-,(2R,3S,4S)-rel-
CAS:Formula:C21H26O7Purity:98.0%Molecular weight:390.4269