
CAS 105738-24-7: 4-methyl-2-oxo-2H-chromen-7-yl chloroacetate
Formula:C12H9ClO4
InChI:InChI=1/C12H9ClO4/c1-7-4-11(14)17-10-5-8(2-3-9(7)10)16-12(15)6-13/h2-5H,6H2,1H3
SMILES:Cc1cc(=O)oc2cc(ccc12)OC(=O)CCl
Synonyms:- acetic acid, 2-chloro-, 4-methyl-2-oxo-2H-1-benzopyran-7-yl ester
Sort by
Found 3 products.
4-Methyl-2-oxo-2H-chromen-7-yl chloroacetate
CAS:4-Methyl-2-oxo-2H-chromen-7-yl chloroacetate is a diffraction experiment with a centrosymmetric structure. The molecule has two carbonyl groups, which are responsible for the shift in the frequency of the molecule. The theory behind this is that the electrons in these groups are more easily excited than those in other parts of the molecule. The functional theory also explains how vibrations of atoms and molecules can be calculated from their theoretical frequencies. This is done by using the principles of quantum mechanics to calculate the lowest energy state for any given molecular structure.Formula:C12H9ClO4Purity:Min. 95%Molecular weight:252.65 g/molRef: 3D-FM121797
Discontinued product