
CAS 105752-04-3: 4-IODO-3-NITROANILINE
Formula:C6H5IN2O2
InChI:InChI=1/C6H5IN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2
SMILES:c1cc(c(cc1N)N(=O)=O)I
Sort by
Found 4 products.
4-Iodo-3-nitroaniline
CAS:4-Iodo-3-nitroaniline is a crystalline solid that belongs to the class of nitrobenzoic acids. It can be synthesized by reacting 4-iodoaniline with nitrous acid and has been shown to be an efficient method for making this compound. The molecular structure of this molecule has been elucidated using single crystal x-ray diffraction, which revealed that it has two possible orientations: one in which the chloride ion is coordinated to the nitrogen atom of the aromatic ring and one in which it is coordinated to the oxygen atom. 4-Iodo-3-nitroaniline has acidic properties and concomitantly forms salts with bases, such as alkali metal chlorides or sodium hydroxide. Crystals are isomorphic, meaning they have the same chemistry but different structural arrangements. In some cases, these differences can lead to a change in chemical properties, such as solubility or stability.Formula:C6H5IN2O2Purity:Min. 95%Molecular weight:264.02 g/mol4-Iodo-3-nitroaniline
CAS:4-Iodo-3-nitroanilineFormula:C6H5IN2O2Purity:>98%Color and Shape: light brown to brown solidMolecular weight:264.02g/mol