
CAS 106018-85-3: 2-(TRIMETHYLSILYL)ETHANESULFONYL CHLORIde
Formula:(CH3)3SiCH2CH2SO2Cl
Synonyms:- 2-Trimethylsilylethylsulfonyl chloride, SES-Cl
- SES-Cl
- 2-(Trimethylsilyl)Ethanesulfonyl Chloride
- 2-(Trimethylsilyl)ethanesulfonyl chloride
Sort by
Found 4 products.
2-Trimethylsilylethanesulfonyl chloride
CAS:2-Trimethylsilylethanesulfonyl chloridePurity:97%Color and Shape:Colourless LiquidMolecular weight:200.76g/mol2-(Trimethylsilyl)ethanesulfonyl chloride
CAS:Formula:C5H13ClO2SSiPurity:95%Color and Shape:LiquidMolecular weight:200.7592-(Trimethylsilyl)ethanesulfonylchloride
CAS:2-(Trimethylsilyl)ethanesulfonylchloride is a n-oxide that can be used for the synthesis of aziridines. It is prepared by the reaction of triphenylphosphine and protonated trimethylsilyl chloride in the presence of amines. The reaction proceeds via an ionic mechanism, which involves the formation of a cationic adduct followed by a nucleophilic attack on the phosphorus atom. The asymmetric synthesis of 2-(trimethylsilyl)ethanesulfonylchloride is achieved through sulfonation and subsequent treatment with sodium nitrite. This method affords two different enantiomers, both are active as chiral auxiliaries in organic synthesis.Formula:C5H13ClO2SSiPurity:Min. 95%Molecular weight:200.76 g/mol