
CAS 1072-70-4: 5-Methyl-2-oxazolidinone
Formula:C4H7NO2
InChI:InChI=1S/C4H7NO2/c1-3-2-5-4(6)7-3/h3H,2H2,1H3,(H,5,6)
InChI key:InChIKey=HBRXQSHUXIJOKV-UHFFFAOYSA-N
SMILES:CC1OC(=O)NC1
Synonyms:- 2-Oxazolidinone, 5-Methyl-
- 5-Methyl-2-oxazolidinone
- 5-Methyloxazolidone
- NSC 169461
- NSC 37750
Sort by
Found 3 products.
5-Methyl-1,3-oxazolidin-2-one
CAS:5-Methyl-1,3-oxazolidin-2-one is a synthetic compound that has been studied for its antiproliferative effects. It inhibits the growth of cancer cells by inducing cell cycle arrest and apoptosis. The structural changes in 5-Methyl-1,3-oxazolidin-2-one are responsible for these effects. The asymmetric carbon atom in the molecule allows for stereoisomeric forms to be produced. When this molecule is exposed to metal halides, it undergoes an epoxidation reaction to form an aziridine ring. This ring can then react with hydrotalcite and water to produce hydrogen gas and a carboxylic acid salt.Formula:C4H7NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:101.1 g/mol5-Methyloxazolidin-2-one
CAS:Formula:C4H7NO2Purity:95%Color and Shape:LiquidMolecular weight:101.10395-methyl-1,3-oxazolidin-2-one
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:101.1050033569336