
CAS 1078-05-3: 4-Nitronicotinic acid N-oxide
Formula:C6H4N2O5
InChI:InChI=1/C6H4N2O5/c9-6(10)4-3-7(11)2-1-5(4)8(12)13/h1-3H,(H,9,10)
SMILES:c1cn(=O)cc(c1N(=O)=O)C(=O)O
Synonyms:- 4-Nitropyridine-3-carboxylic acid N-oxide
- 4-Nitropyridine-3-Carboxylic Acid 1-Oxide
Sort by
Found 3 products.
4-Nitronicotinic acid N-oxide
CAS:4-Nitronicotinic acid N-oxidePurity:97%Molecular weight:184.11g/mol4-Nitronicotinic acid N-oxide
CAS:Formula:C6H4N2O5Purity:95%Color and Shape:SolidMolecular weight:184.10644-Nitronicotinic acidn-oxide
CAS:4-Nitronicotinic acidn-oxide is a pyridine compound that has a nitro group as a substituent. It is soluble in water and can be extracted with organic solvents. 4-Nitronicotinic acidn-oxide has a trackable isotope, which can be used to study its reactions with other compounds. This chemical has the molecular formula C6H5NO2N3O2, and its molecular weight is 169.037 g/mol. The IUPAC name of this compound is 4-nitronitrobenzoic acid oxime.Formula:C6H4N2O5Purity:Min. 95%Molecular weight:184.11 g/molRef: 3D-FN149744
Discontinued product