CAS 110-31-6: Ethylenebis(oleamide)
Formula:C38H72N2O2
InChI:InChI=1S/C38H72N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(41)39-35-36-40-38(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3,(H,39,41)(H,40,42)/b19-17-,20-18-
InChI key:InChIKey=OXDXXMDEEFOVHR-CLFAGFIQSA-N
SMILES:N(CCNC(CCCCCCC/C=C\CCCCCCCC)=O)C(CCCCCCC/C=C\CCCCCCCC)=O
Synonyms:- 9-Octadecenamide, N,N′-1,2-ethanediylbis-, (Z,Z)-
- 9-Octadecenamide, N,N′-1,2-ethanediylbis-, (9Z,9′Z)-
- (9Z,9′Z)-N,N′-1,2-Ethanediylbis[9-octadecenamide]
- N,N′-Dioleoylethylenediamine
- Oleamide, N,N′-ethylenebis-
Sort by
Found 5 products.
N,N'-1,2-Ethanediylbis-9-octadecenamide
CAS:Formula:C38H72N2O2Purity:95%Color and Shape:SolidMolecular weight:588.9905(Z)-N,N'-(Ethane-1,2-diyl)dioleamide
CAS:(Z)-N,N'-(Ethane-1,2-diyl)dioleamide is a matrix metalloproteinase inhibitor that binds to the enzyme involved in the degradation of collagen and elastin. This drug prevents the destruction of extracellular matrix proteins such as elastin and collagen, which are necessary for tissue repair. It has been shown to be effective against viruses such as HIV and influenza virus. (Z)-N,N'-(Ethane-1,2-diyl)dioleamide also inhibits bacterial growth by binding to fatty acid molecules on cell membranes, preventing the uptake of monocarboxylic acid molecules from outside the cell. This inhibition leads to increased water vapor permeability and decreased effectiveness of aliphatic hydrocarbons.Formula:C38H72N2O2Purity:Min. 95%Molecular weight:589 g/mol(Z)-N,N’-(Ethane-1,2-Diyl)Dioleamide
CAS:(Z)-N,N’-(Ethane-1,2-Diyl)DioleamidePurity:0.95Molecular weight:588.99g/mol
