B-(2-Bromo-6-chlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both bromine and chlorine atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is a common trait of boronic acids due to their ability to form hydrogen bonds. The presence of halogen substituents can influence its reactivity, making it useful in various organic synthesis applications, particularly in cross-coupling reactions like Suzuki-Miyaura coupling. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor technology and drug delivery systems. The compound's specific reactivity and stability can be affected by factors such as pH and the presence of other functional groups in a reaction mixture. Overall, B-(2-Bromo-6-chlorophenyl)boronic acid serves as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.

B-(2-Bromo-6-chlorophenyl)boronic acid

1107580-65-3: Boronic acid, B-(2-bromo-6-chlorophenyl)-, B-(2-Bromo-6-chlorophenyl)boronic acid

CAS 1107580-65-3: B-(2-Bromo-6-chlorophenyl)boronic acid

2-Bromo-6-chlorophenylboronic acid

Ref: 3D-HUB58065

2-Bromo-6-chlorophenylboronic acid

Ref: 54-OR360197

(2-Bromo-6-chlorophenyl)boronic acid

Ref: 10-F225750

2-Bromo-6-chlorophenylboronic acid

Ref: IN-DA003BLX