
CAS 111025-83-3: Vinigrol
Formula:C20H34O3
InChI:InChI=1S/C20H34O3/c1-11(2)15-7-5-12(3)16-8-6-13(4)20(23)17(15)9-14(10-21)19(22)18(16)20/h9,11-13,15-19,21-23H,5-8,10H2,1-4H3/t12-,13-,15-,16+,17+,18+,19-,20+/m1/s1
InChI key:InChIKey=WVVCBUGDSFLEHX-SBNBNJMHSA-N
SMILES:O[C@]12[C@]3([C@]([C@H](C)CC[C@H](C(C)C)[C@@]1(C=C(CO)[C@H]3O)[H])(CC[C@H]2C)[H])[H]
Synonyms:- (1R,4S,4aS,5S,8R,8aS,9R,12R)-4,4a,5,6,7,8-Hexahydro-3-(hydroxymethyl)-8,9-dimethyl-12-(1-methylethyl)-1,5-butanonaphthalene-4,8a(1H)-diol
- (1R,4S,4aS,5S,8R,8aS,9S,12S)-3-(hydroxymethyl)-8,12-dimethyl-9-(1-methylethyl)-4,4a,5,6,7,8-hexahydro-1,5-butanonaphthalene-4,8a(1H)-diol
- 1,5-Butanonaphthalene-4,8a(1H)-diol, 4,4a,5,6,7,8-hexahydro-3-(hydroxymethyl)-8,9-dimethyl-12-(1-methylethyl)-, (1R,4S,4aS,5S,8R,8aS,9R,12R)-
- 1,5-Butanonaphthalene-4,8a(1H)-diol, 4,4a,5,6,7,8-hexahydro-8,9-dimethyl-3-(hydroxymethyl)-12-(1-methylethyl)-, (1R-(1-alpha,4-beta,4a-beta,5-alpha,8-beta,8a-beta,9S*,12S*))-
- Antibiotic FR 900478
- Brn 5063688
- Vinigrol
Sort by
Found 2 products.
(-)-Vinigrol
CAS:(-)-Vinigrol is a naturally occurring diterpenoid, which is originally isolated from the fungal species Virgaria nigra, known for its complex stereochemistry and unique structure. It functions as a bioactive compound with multiple mechanisms of action, including modulation of signal transduction pathways and inhibition of specific enzymes, contributing to its broad spectrum of biological activities. The compound's intricate mechanism involves interactions with cellular pathways, such as those related to inflammation, and it has shown potential in modulating immune responses. Its applications span diverse fields, with ongoing research exploring its therapeutic potential, particularly due to its anti-inflammatory, anti-hypertensive, and immunosuppressive properties. In scientific studies, (-)-Vinigrol serves as a valuable molecule for probing biological processes and has inspired synthetic chemists to develop efficient methods for its total synthesis, which further aids in examining its pharmacological properties. Its unique structure and biological activity make it a subject of considerable interest in natural product chemistry and pharmacology, highlighting the significance of natural compounds in drug discovery and development.Purity:Min. 95%Vinigrol
CAS:Vinigrol is an antihypertensive and platelet aggregation inhibitory agent produced by a fungus, Virgaria nigra. II.Formula:C20H34O3Color and Shape:SolidMolecular weight:322.48