
CAS 111331-82-9: 3-(boc-amino)benzoic acid
Formula:C12H14NO4
InChI:InChI=1/C12H15NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h4-7H,1-3H3,(H,13,16)(H,14,15)/p-1
SMILES:CC(C)(C)OC(=Nc1cccc(c1)C(=O)[O-])O
Synonyms:- Boc-3-Abz-OH
- 3-(Tert-Butoxycarbonyl)-Amino Benzoic Acid
- 3-[(Tert-Butoxycarbonyl)Amino]Benzoate
Sort by
Found 5 products.
3-{[(tert-Butoxy)carbonyl]amino}benzoic acid
CAS:3-{[(tert-Butoxy)carbonyl]amino}benzoic acidPurity:98+%Molecular weight:237.25g/mol3-(Boc-Amino)benzoic acid
CAS:Formula:C12H15NO4Purity:98%Color and Shape:SolidMolecular weight:237.25183-(n-Boc amino)benzoic acid
CAS:3-(n-Boc amino)benzoic acid is a coupling agent that can be used in the synthesis of anilines. It has a chloride group and an aminobenzoic acid group. The compound is synthesized from terephthaloyl chloride and 3-aminobenzoic acid. This method is scalable, and 3-(n-Boc amino)benzoic acid is used to couple anilines with other chemical compounds.Purity:Min. 95%Ref: 3D-FB12600
Discontinued product