CAS 111466-41-2: MK-912
Formula:C20H25N3O2
InChI:InChI=1/C20H25N3O2/c1-21-11-8-20(22(2)19(21)24)9-12-23-10-7-15-14-5-3-4-6-17(14)25-18(15)16(23)13-20/h3-6,16H,7-13H2,1-2H3
SMILES:CN1CCC2(CCN3CCc4c5ccccc5oc4C3C2)N(C)C1=O
Synonyms:- L 657743
- 1',3'-Dimethylspiro(1,3,4,5',6,6',7,12b-octahydro-2H-benzo(b)furo(2,3-a)quinolizine)-2,4'-pyrimidin-2'-one
- L-657,743-002W
- Spiro(2H-benzofuro(2,3-a)quinolizine-2,4'(1'H)-pyrimidin)-2'(3'H)-one, 1,3,4,5',6,6',7,12b-octahydro-1',3'-dimethyl-, (2S-trans)-
- 1',3'-dimethyl-1,3,4,5',6,6',7,12b-octahydro-1'H-spiro[1-benzofuro[2,3-a]quinolizine-2,4'-pyrimidin]-2'(3'H)-one
Sort by
Found 3 products.
L 657743
CAS:L 657743 is an Adrenergic alpha-Antagonist.Formula:C20H25N3O2Color and Shape:SolidMolecular weight:339.43Mk-912 hydrochloride hydrate
CAS:MK-912 hydrochloride hydrate is a selective and potent antagonist of the α2-adrenoceptor, which is a type of biochemical compound used to study the sympathetic nervous system. Derived synthetically, its development stems from ongoing research into adrenergic receptors, primarily focusing on their role in neurotransmitter regulation. Its mode of action involves blocking the α2-adrenergic receptors, which leads to increased release of norepinephrine and other neurotransmitters, affecting heart rate and blood pressure, among other physiological parameters. This compound is extensively applied in research settings to investigate the pharmacological effects of α2-adrenoceptor blockade. Its utility spans across studies in cardiovascular research, neuropharmacology, and potential therapeutic implications for conditions such as depression and anxiety. By examining the effects of MK-912 hydrochloride hydrate, scientists can better understand the complexities of adrenergic signaling and explore potential clinical interventions for related disorders.Formula:C20H25N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:339.4 g/mol
