
CAS 1119-75-1: 2-chloroethyl stearate
Formula:C20H39ClO2
InChI:InChI=1/C20H39ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h2-19H2,1H3
SMILES:CCCCCCCCCCCCCCCCCC(=O)OCCCl
Synonyms:- Ai3-03512
- Octadecanoic acid, 2-chloroethyl ester
- 2-Chloroethyl Octadecanoate
- 2-Chloroethyl stearate
Sort by
Found 3 products.
2-Chloroethyl stearate
CAS:2-Chloroethyl stearate is a fatty acid ester that is used in the preparation of conjugates. It is synthesized by reacting 2-chloroethyl chloride with an unsaturated fatty acid, such as oleic acid. The chemical ionization mass spectrometry (CI MS) technique can be used to identify 2-chloroethyl stearate from other fatty acid esters, because it has a distinctive molecular ion peak at m/z=232. Preparative high-performance liquid chromatography (HPLC) can also be used to isolate the molecule. The chemical structure of 2-chloroethyl stearate consists of a carboxylic acid group and a chloroethyl group. Acid conjugates are prepared by reacting the molecule with an alcohol in the presence of an acid catalyst. 2-Chloroethyl stearate is commonly found in sugar esters and fatty acids.br>br> 2-ChloroFormula:C20H39ClO2Purity:Min. 95%Molecular weight:347 g/mol2-Chloroethyl stearate
CAS:Formula:C20H39ClO2Purity:95%Color and Shape:SolidMolecular weight:346.9755