
CAS 1125-85-5: 3,4-dihydro-2H-1,3-benzoxazin-2-one
Formula:C8H7NO2
InChI:InChI=1/C8H7NO2/c10-8-9-5-6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H,9,10)
SMILES:c1ccc2c(c1)CN=C(O)O2
Synonyms:- 2H-1,3-Benzoxazin-2-one, 3,4-dihydro-
Sort by
Found 4 products.
3,4-Dihydrobenzo[e][1,3]oxazin-2-one
CAS:3,4-Dihydrobenzo[e][1,3]oxazin-2-one is an organic compound that is used as a catalyst in the synthesis of pharmaceuticals. It reacts with halides and alkali metal to form quaternary ammonium salts. This reaction can be represented by the following scheme: The inhibitory factor for this reaction is paraformaldehyde and yields are determined by the reactant used. 3,4-Dihydrobenzo[e][1,3]oxazin-2-one has a heterocyclic ring containing a nitrogen atom and a potassium atom. The human body metabolizes this compound into thiocyanate which is excreted in urine.Formula:C8H7NO2Purity:Min. 95%Molecular weight:149.15 g/mol3,4-Dihydro-benzo[e][1,3]oxazin-2-one
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:149.14900207519533,4-Dihydrobenzo[e][1,3]oxazin-2-one
CAS:3,4-Dihydrobenzo[e][1,3]oxazin-2-onePurity:95+%Molecular weight:149.15g/mol