CAS 1127-01-1: Cyclohexanecarboxylic acid, 1-hydroxy-, ethyl ester
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-2-12-8(10)9(11)6-4-3-5-7-9/h11H,2-7H2,1H3
InChI key:InChIKey=LVGBBZRMRVLEFH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(O)CCCCC1
Synonyms:- 1-Hydroxycyclohexanecarboxylic acid ethyl ester
- Cyclohexanecarboxylic acid, 1-hydroxy-, ethyl ester
- Ethyl 1-hydroxycyclohexane-1-carboxylate
- Ethyl 1-hydroxycyclohexanecarboxylate
- NSC 7384
Sort by
Found 4 products.
Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Formula:C9H16O3Purity:96%Color and Shape:LiquidMolecular weight:172.2215Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:172.2239990234375Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Ethyl 1-hydroxycyclohexanecarboxylate is an aliphatic, cyclic compound that belongs to the group of superacids. It is a byproduct of the reaction between benzene and ethyl chloroformate. This reaction requires a catalyst, such as potassium tert-butoxide or tetrabutylammonium fluoride. The molecule has a tetrahydrofuran ring with a hydroxy group and can be classified as an aldehyde, which is formed by the removal of two hydrogen atoms from the carbonyl carbon atom. Ethyl 1-hydroxycyclohexanecarboxylate also undergoes a shift in its equilibrium position when it interacts with other compounds, such as elemental analysis or five-membered hydrocarbons.Formula:C9H16O3Purity:Min. 95%Molecular weight:172.22 g/molEthyl 1-hydroxycyclohexanecarboxylate
CAS:Ethyl 1-hydroxycyclohexanecarboxylatePurity:95%Molecular weight:172.22g/mol
