
CAS 112822-85-2: 2,4,5-Trifluoro-3-methylbenzoic acid
Formula:C8H5F3O2
InChI:InChI=1/C8H5F3O2/c1-3-6(10)4(8(12)13)2-5(9)7(3)11/h2H,1H3,(H,12,13)
SMILES:Cc1c(c(cc(c1F)F)C(=O)O)F
Synonyms:- 3-Methyl-2,4,5-Trifluorobenzoic Acid
- 2,4,5-Trifluoro-3-Methyl Benzoic Acid
- 3-Methyl-2,4,5-TrifluorobenzoicAcid99%
- 3-Methyl-2,4,5-Trifluorobenzoic Acid 99%
Sort by
Found 4 products.
3-Methyl-2,4,5-trifluorobenzoic acid
CAS:3-Methyl-2,4,5-trifluorobenzoic acidPurity:95%Molecular weight:190.12g/mol3-Methyl-2,4,5-trifluorobenzoic acid
CAS:3-Methyl-2,4,5-trifluorobenzoic acid is a fluoroquinolone antibiotic that inhibits the DNA gyrase and topoisomerase IV. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division. 3-Methyl-2,4,5-trifluorobenzoic acid has been shown to be bactericidal in vitro against Gram-negative bacteria such as Escherichia coli and Pseudomonas aeruginosa. This drug also has a target enzyme modification activity with the potential to modify enzymes not usually targeted by fluoroquinolones.Formula:C8H5F3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:190.12 g/mol2,4,5-Trifluoro-3-methylbenzoic acid
CAS:Formula:C8H5F3O2Purity:97%Color and Shape:SolidMolecular weight:190.11932,4,5-Trifluoro-3-methylbenzoic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:190.12100219726562