
CAS 113118-82-4: 5-Chloro-3-pyridinecarboxaldehyde
Formula:C6H4ClNO
InChI:InChI=1S/C6H4ClNO/c7-6-1-5(4-9)2-8-3-6/h1-4H
InChI key:InChIKey=BCELHNLIYYAOLV-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(Cl)C=NC1
Synonyms:- 3-Chloro-5-formylpyridine
- 3-Pyridinecarboxaldehyde, 5-chloro-
- 3-Pyridinecarboxaldehyde,5-chloro-(9CI)
- 5-Chloro-3-pyridinecarbaldehyde
- 5-Chloro-3-pyridinecarboxaldehyde
- 5-Chloronicotinaldehyde
- 5-Chloropyridine-3-carboxaldehyde
Sort by
Found 5 products.
5-Chloropyridine-3-carbaldehyde
CAS:5-Chloropyridine-3-carbaldehyde is a chemical compound that has been studied for its biological effects. It has shown significant activity against DU145 prostate carcinoma cells and human fibroblast cells. This compound has also been shown to have pharmacological properties, including inhibition of thiosemicarbazide, du145, and mcf-7 cells. 5-Chloropyridine-3-carbaldehyde is an aromatic compound that belongs to the group of heterocyclic compounds. It is also known as 2,5-dichloroisonicotinic acid or 3-(2,5-dichlorophenyl)pyridinecarboxaldehyde. The molecular formula is C8H6Cl2O2 and the molecular weight is 228.23 g/mol. The structure was determined by x-ray diffraction techniques and the conformation was determined through techniques such as nuclear magnetic resonance spectroscopy (NMR).Formula:C6H4ClNOPurity:Min. 95%Molecular weight:141.55 g/molRef: 3D-FC147430
Discontinued product5-Chloronicotinaldehyde
CAS:Formula:C6H4ClNOPurity:97%Color and Shape:SolidMolecular weight:141.555065-Chloronicotinaldehyde
CAS:5-ChloronicotinaldehydeFormula:C6H4ClNOPurity:By gc: 97.6% (Typical Value in Batch COA)Color and Shape: solidMolecular weight:141.56g/mol