
CAS 113882-33-0: 5-Nitro-3-Methyl benzoic acid
Formula:C8H7NO4
InChI:InChI=1S/C8H7NO4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3,(H,10,11)
SMILES:Cc1cc(cc(c1)N(=O)=O)C(=O)O
Synonyms:- 3-Methyl-5-Nitrobenzoic Acid
- Benzoic acid, 3-methyl-5-nitro-
Sort by
Found 4 products.
Benzoic acid, 3-methyl-5-nitro-
CAS:Formula:C8H7NO4Purity:98%Color and Shape:SolidMolecular weight:181.14553-Methyl-5-nitrobenzoic acid
CAS:Purity:95.0%Color and Shape:Solid, White powderMolecular weight:181.147003173828123-Methyl-5-nitrobenzoic acid
CAS:3-Methyl-5-nitrobenzoic acid is a carbanion that can be activated by sodium hypochlorite. It has oxidant properties and can be used as an alicyclic or unactivated ketone to form heteroaromatic compounds. 3-Methyl-5-nitrobenzoic acid is also a resonance stabilizer, which prevents the formation of reactive free radicals. This compound is also able to halogenate aromatic rings, including benzene rings, and can activate benzenoid compounds with electron withdrawing groups like nitro groups. 3-Methyl-5-nitrobenzoic acid is also a carboxylic acid that reacts with heteroaromatic compounds to form carboxylates.Formula:C8H7NO4Purity:Min. 95%Molecular weight:181.15 g/molRef: 3D-FM140158
Discontinued product