
CAS 114420-67-6: (2S)-3-(acetyloxy)-2-(hexopyranosyloxy)propyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate
Formula:C20H26O11
InChI:InChI=1/C20H26O11/c1-11(22)28-9-14(30-20-19(27)18(26)17(25)15(8-21)31-20)10-29-16(24)7-4-12-2-5-13(23)6-3-12/h2-7,14-15,17-21,23,25-27H,8-10H2,1H3/b7-4+/t14-,15?,17?,18?,19?,20?/m0/s1
Sort by
Found 5 products.
Regaloside B
CAS:Regaloside B, a phenylpropanoid isolated from Lilium longiflorum, exhibits anti-inflammatory activity by inhibiting the expression of iNOS (inducible nitricFormula:C20H26O11Purity:97.34% - 99.4%Color and Shape:SolidMolecular weight:442.41Regaloside B
CAS:Regaloside B is a pentacyclic triterpene that has been found to have antioxidant effects. It also inhibits the production of 5-hmf, an important mediator in the inflammatory response. Regaloside B has been shown to be effective in inhibiting cell morphology changes and mitochondrial membrane potential in various types of cells. The activity test for this compound is based on its ability to inhibit the production of nitric oxide (NO) and tumor necrosis factor-α (TNF-α). Chemical structures, fingerprint analysis, and biodegradability are some of the analytical methods used to identify Regaloside B.Formula:C20H26O11Purity:Min. 95%Molecular weight:442.4 g/mol