
CAS 114567-34-9: Boeravinone B
Formula:C17H12O6
InChI:InChI=1S/C17H12O6/c1-7-9(18)6-11-13(14(7)19)15(20)12-8-4-2-3-5-10(8)23-17(21)16(12)22-11/h2-6,17-19,21H,1H3
InChI key:InChIKey=YVVDYYFGAWQOGB-UHFFFAOYSA-N
SMILES:O=C1C2=C(OC=3C1=C(O)C(C)=C(O)C3)C(O)OC=4C2=CC=CC4
Synonyms:- 6,9,11-Trihydroxy-10-methyl[1]benzopyrano[3,4-b][1]benzopyran-12(6H)-one
- Boeravinone B
- Melavoid
- [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one,6,9,11-trihydroxy-10-methyl-, (?à)-
- [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-, (±)-
- [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-
Sort by
Found 6 products.
[1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-
CAS:Formula:C17H12O6Molecular weight:312.2736Boeravinone b
CAS:Oxygen-heterocyclic compoundFormula:C17H12O6Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:312.286,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid
CAS:6,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid is a synthetic retinoid, which is derived from chemical modification of natural retinoids, compounds related to vitamin A. Its mode of action involves the regulation of gene expression by binding to retinoic acid receptors (RARs) and retinoid X receptors (RXRs), thereby modulating cellular differentiation, proliferation, and apoptosis pathways. In the context of uses and applications, this compound is primarily investigated for its potential anticancer properties. By influencing cell growth and apoptosis, it holds promise in the treatment of certain malignancies. Its capability to modulate gene expression makes it a candidate for targeted cancer therapies, particularly in tumors where differentiation therapy is applicable. Research into this compound could contribute to the development of novel therapeutic strategies, providing deeper insights into the mechanisms of retinoid-based antineoplastic interventions.Formula:C17H12O6Purity:Min. 95%Molecular weight:312.27 g/mol