CAS 1146-04-9: illudin M
Formula:C15H20O3
InChI:InChI=1S/C15H20O3/c1-8-10-9(7-13(2,3)12(10)17)11(16)14(4,18)15(8)5-6-15/h7,12,17-18H,5-6H2,1-4H3/t12-,14+/m1/s1
InChI key:InChIKey=QVMDIQLUNODCTG-OCCSQVGLSA-N
SMILES:CC=1C2([C@@](C)(O)C(=O)C=3C1[C@@H](O)C(C)(C)C3)CC2
Synonyms:- (3'S,6'R)-3',6'-dihydroxy-2',2',4',6'-tetramethyl-2',3'-dihydrospiro[cyclopropane-1,5'-inden]-7'(6'H)-one
- (3′S,6′R)-2′,3′-Dihydro-3′,6′-dihydroxy-2′,2′,4′,6′-tetramethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one
- Brn 2286081
- Ccris 3539
- Dr-15977
- Illudine M
- Nsc 400978
- Nsc 626370
- Spiro(cyclopropane-1,5'-(5H)inden)-7'(6'H)-one, 2',3'-dihydro-3'-beta,6'-alpha-dihydroxy-2',24',6'-tetramethyl-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 2′,3′-dihydro-3′,6′-dihydroxy-2′,2′,4′,6′-tetramethyl-, (3′S,6′R)-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 2′,3′-dihydro-3′,6′-dihydroxy-2′,2′,4′,6′-tetramethyl-, (3′S-trans)-
- See more synonyms
Sort by
Found 3 products.
Illudin M
CAS:Illudin M is a natural compound, categorized as a sesquiterpene. It is derived from certain species of mushrooms, notably those in the Omphalotus genus, such as the jack-o'-lantern mushroom (Omphalotus illudens). The mode of action of Illudin M involves targeting and damaging DNA within cells. Due to its cytotoxic nature, it interferes with DNA synthesis, leading to cell death, particularly in rapidly dividing cells. Illudin M has garnered interest for its potential applications in cancer research. In oncology, its ability to selectively target and destroy malignant cells has been explored, providing insights into the development of more effective chemotherapeutic agents. Research has focused on modifying its structure to enhance its therapeutic index, reducing toxicity while retaining antitumoral efficacy. Additionally, Illudin M and its derivatives serve as valuable tools in studying cellular responses to DNA damage, offering a deepened understanding of biochemical pathways involved in cell cycle regulation and apoptosis.Formula:C15H20O3Purity:Min. 95%Molecular weight:248.14124Illudin M
CAS:Illudin M is a cytotoxic sesquiterpene from the fungus O.Formula:C15H20O3Purity:99.56%Color and Shape:SolidMolecular weight:248.32
