
CAS 114953-81-0: 2-(2-nitrophenyl)acetohydrazide
Formula:C8H9N3O3
InChI:InChI=1/C8H9N3O3/c9-10-8(12)5-6-3-1-2-4-7(6)11(13)14/h1-4H,5,9H2,(H,10,12)
SMILES:c1ccc(c(c1)CC(=NN)O)N(=O)=O
Synonyms:- Benzeneacetic Acid, 2-Nitro-, Hydrazide
Sort by
Found 4 products.
2-(2-Nitrophenyl)acetohydrazide
CAS:2-(2-Nitrophenyl)acetohydrazide is a nitro compound that is used in the synthesis of other compounds. It has been shown to have a dihedral angle of 36.6° with hydrogen bonds between the two nitro groups and the two benzene rings. The compound has one nitro group, which is responsible for its red colour, and a benzene ring containing a double bond, which gives it its aromatic properties.Formula:C8H9N3O3Purity:Min. 95%Molecular weight:195.18 g/mol2-(2-Nitrophenyl)acetohydrazide
CAS:2-(2-Nitrophenyl)acetohydrazidePurity:95%Molecular weight:195.18g/molBenzeneacetic acid, 2-nitro-, hydrazide
CAS:Formula:C8H9N3O3Purity:%Color and Shape:SolidMolecular weight:195.1754