
CAS 115416-53-0: Nitropyridylphenylalaninol; 98%
Formula:C14H15N3O3
InChI:InChI=1/C14H15N3O3/c18-10-12(8-11-4-2-1-3-5-11)16-14-7-6-13(9-15-14)17(19)20/h1-7,9,12,18H,8,10H2,(H,15,16)/t12-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](CO)Nc1ccc(cn1)N(=O)=O
Synonyms:- (S)-N-(5-Nitro-2-pyridyl)phenylalaninol
Sort by
Found 2 products.
Benzenepropanol, β-[(5-nitro-2-pyridinyl)amino]-, (βS)-
CAS:Formula:C14H15N3O3Molecular weight:273.2872(S)-N-(5-Nitro-2-pyridyl)phenylalaninol
CAS:(S)-N-(5-Nitro-2-pyridyl)phenylalaninol is the crystalline form of a yellow powder with an index of refraction of 1.6. It has a crystallographic space group P212121 and crystal structure that can be determined by x-ray analysis. The crystals are monoclinic, with a unit cell dimension of a = 7.858 Å, b = 10.36 Å, c = 6.04 Å, α = 89°, β = 90°, γ = 90° and Z = 4.Purity:Min. 95%Ref: 3D-FN62446
Discontinued product