
CAS 1169806-02-3: (3aS,5aR,5bS,7aR,11S,11aS,13aS,13bS)-3,3a,4,5,5a,5b,6,7,8,9,10,11,11a,13,13a,13b-Hexadecahydro-11-hydroxy-1-(hydroxymethyl)-3,3,5a,5b,10,10,13b-heptamethyl-7aH-cyclopenta[a]chrysene-7a-carboxylic acid
Formula:C30H46O4
InChI:InChI=1S/C30H46O4/c1-25(2)12-14-30(24(33)34)15-13-27(5)19(22(30)23(25)32)8-9-21-28(27,6)11-10-20-26(3,4)16-18(17-31)29(20,21)7/h8,16,20-23,31-32H,9-15,17H2,1-7H3,(H,33,34)/t20-,21-,22+,23-,27+,28+,29-,30-/m0/s1
InChI key:InChIKey=ABBHOGULYDHHCV-XENLZXDWSA-N
SMILES:C[C@@]12[C@@]3([C@](C)([C@@]4(C)C(=CC3)[C@]5([C@@](C(O)=O)(CC4)CCC(C)(C)[C@H]5O)[H])CC[C@]1(C(C)(C)C=C2CO)[H])[H]
Synonyms:- (3aS,5aR,5bS,7aR,11S,11aS,13aS,13bS)-3,3a,4,5,5a,5b,6,7,8,9,10,11,11a,13,13a,13b-Hexadecahydro-11-hydroxy-1-(hydroxymethyl)-3,3,5a,5b,10,10,13b-heptamethyl-7aH-cyclopenta[a]chrysene-7a-carboxylic acid
- 7aH-Cyclopenta[a]chrysene-7a-carboxylic acid, 3,3a,4,5,5a,5b,6,7,8,9,10,11,11a,13,13a,13b-hexadecahydro-11-hydroxy-1-(hydroxymethyl)-3,3,5a,5b,10,10,13b-heptamethyl-, (3aS,5aR,5bS,7aR,11S,11aS,13aS,13bS)-
- Sculponeatic acid
- Sculponeaticacid
Sort by
Found 3 products.
Sculponeatic acid
CAS:Controlled ProductSculponeatic acid is a secondary metabolite, which is a bioactive compound produced by certain fungi. It is derived from specific fungal strains known for their diverse ecological roles, including interactions with other microorganisms and plants. The mode of action of sculponeatic acid involves its allelopathic properties, whereby it influences the growth and development of nearby organisms through chemical means. This includes inhibiting seed germination and reducing the growth of competing plant species, thereby giving a competitive advantage to the organism producing it. In scientific research, sculponeatic acid is primarily used to study its ecological role and potential applications in agriculture. Its ability to modulate plant interactions makes it a compound of interest for developing natural herbicides or growth regulators. By understanding its molecular structure and activity, scientists aim to harness its properties to develop environmentally friendly solutions for weed management and crop improvement, thereby contributing to sustainable agricultural practices. The investigations surrounding sculponeatic acid continue to expand our knowledge of microbial interactions and natural product chemistry.Formula:C30H46O4Purity:Min. 95%Molecular weight:470.7 g/molSculponeatic acid
CAS:Sculponeatic acid is a natural product of Isodon, Lamiaceae.Formula:C30H46O4Purity:98%Color and Shape:SolidMolecular weight:470.68