![4-[4-[[(2S)-2-(3,5-Dimethylphenyl)-1-pyrrolidinyl]methyl]phenoxy]-3-fluorobenzamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F464776-4-4-2s-2-35-dimethylphenyl-1-pyrrolidinyl-methyl-phenoxy-3-fluorobenzamide.webp&w=3840&q=75)
CAS 1174130-61-0: 4-[4-[[(2S)-2-(3,5-Dimethylphenyl)-1-pyrrolidinyl]methyl]phenoxy]-3-fluorobenzamide
Formula:C26H27FN2O2
InChI:InChI=1S/C26H27FN2O2/c1-17-12-18(2)14-21(13-17)24-4-3-11-29(24)16-19-5-8-22(9-6-19)31-25-10-7-20(26(28)30)15-23(25)27/h5-10,12-15,24H,3-4,11,16H2,1-2H3,(H2,28,30)/t24-/m0/s1
InChI key:InChIKey=ZHPMYDSXGRRERG-DEOSSOPVSA-N
SMILES:C(N1[C@@H](CCC1)C2=CC(C)=CC(C)=C2)C3=CC=C(OC4=C(F)C=C(C(N)=O)C=C4)C=C3
Synonyms:- LY2456302
- Benzamide, 4-[4-[[(2S)-2-(3,5-dimethylphenyl)-1-pyrrolidinyl]methyl]phenoxy]-3-fluoro-
- Aticaprant
- 4-[4-[[(2S)-2-(3,5-Dimethylphenyl)-1-pyrrolidinyl]methyl]phenoxy]-3-fluorobenzamide
- LY 2456302
- CERC 501
- (S)-4-(4-((2-(3,5-diMethylphenyl)pyrrolidin-1-yl)Methyl)phenoxy)-3-fluorobenzaMide
Sort by
Found 3 products.
Aticaprant
CAS:Aticaprant is a water-soluble chiral amine that belongs to the class of amines. It is commonly used in the production of medicines and research chemicals. Aticaprant has a wide range of applications in the pharmaceutical industry, particularly in the development of medicaments. This compound is often used as a solid catalyst in various chemical reactions due to its high reactivity and stability. Additionally, Aticaprant exhibits binding affinity for estrogen receptors, making it useful in hormone-related research studies. Its unique structure, which includes oxazole derivatives and an amide group, contributes to its versatility and effectiveness as a pharmaceutical ingredient. Aticaprant is typically synthesized using sodium methylate and phosphoric acid under controlled conditions to ensure purity and quality.Formula:C26H27FN2O2Purity:Min. 95%Molecular weight:418.5 g/molRef: 3D-ZWB13061
Discontinued productAticaprant
CAS:Aticaprant (CERC-501) is a potent and centrally-penetrant antagonist of the kappa-opioid receptor (Ki: 0.807 nM).Cost-effective and quality-assured.Formula:C26H27FN2O2Purity:99.53% - 99.93%Color and Shape:SolidMolecular weight:418.5Ref: TM-TQ0082
1mg40.00€2mg52.00€5mg88.00€10mg126.00€25mg259.00€50mg406.00€100mg607.00€1mL*10mM (DMSO)87.00€
