![6-methoxy-2-oxo-2H-chromen-7-yl 6-O-[3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]hexopyran…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F405850-6-methoxy-2-oxo-2h-chromen-7-yl-6-o-34-dihydroxy-4-hydroxymethyl-tetrahydrofuran-2-yl-hexopyranoside.webp&w=3840&q=75)
CAS 117842-09-8: 6-methoxy-2-oxo-2H-chromen-7-yl 6-O-[3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]hexopyranoside
Formula:C21H26O13
InChI:InChI=1/C21H26O13/c1-29-11-4-9-2-3-14(23)32-10(9)5-12(11)33-19-17(26)16(25)15(24)13(34-19)6-30-20-18(27)21(28,7-22)8-31-20/h2-5,13,15-20,22,24-28H,6-8H2,1H3
SMILES:COc1cc2ccc(=O)oc2cc1OC1C(C(C(C(COC2C(C(CO)(CO2)O)O)O1)O)O)O
Sort by
Found 2 products.
Hymexelsin
CAS:Hymexelsin is an advanced biopesticide, which is derived from naturally occurring compounds sourced from plant extracts. It operates through a novel mechanism that disrupts specific biochemical pathways essential for pest survival and reproduction. By targeting these pathways, Hymexelsin interferes with critical physiological processes, leading to the effective control of a broad spectrum of agricultural pests. The application of Hymexelsin spans various agricultural environments, where it is utilized for its efficiency in protecting crops without the adverse environmental impacts associated with synthetic pesticides. Its selectivity ensures that beneficial insects and non-target organisms are minimally affected, thus maintaining ecological balance. Hymexelsin is particularly valued in integrated pest management (IPM) programs, offering a sustainable and environmentally conscious solution to pest control. Researchers and practitioners appreciate its compatibility with current farming practices and its contribution to reducing chemical residues in food products. This makes Hymexelsin a significant advancement in the field of sustainable agriculture, where its use aligns with the growing demand for innovative and ecosystem-friendly pest management strategies.Formula:C21H26O13Purity:Min. 95%Molecular weight:486.4 g/mol