
CAS 118-44-5: N-Ethyl-1-naphthalenamine
Formula:C12H13N
InChI:InChI=1S/C12H13N/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13H,2H2,1H3
InChI key:InChIKey=KDFFXYVOTKKBDI-UHFFFAOYSA-N
SMILES:N(CC)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- 1-(Ethylamino)naphthalene
- 1-Naphthalenamine, N-ethyl-
- 1-Naphthylamine, N-ethyl-
- Ethyl-α-naphthylamine
- N-Ethyl-1-aminonaphthalene
- N-Ethyl-1-naphthalenamine
- N-Ethyl-1-naphthylamine
- N-Ethyl-α-naphthylamine
- N-ethylnaphthalen-1-amine
- NSC 8636
Sort by
Found 3 products.
N-Ethylnaphthalen-1-amine
CAS:N-Ethylnaphthalen-1-amineFormula:C12H13NPurity:98%Color and Shape: colourless liquidMolecular weight:171.24g/molN-Ethyl-1-naphthylamine
CAS:N-Ethyl-1-naphthylamine is an alkylating agent that can react with DNA, RNA and proteins. It reacts with a carbonyl group to form an alkylthio group and an amine, which can then react with other molecules to form covalent bonds. N-Ethyl-1-naphthylamine is carcinogenic and genotoxic, meaning it causes cancer and damages the genetic information of cells. The carcinogenic activity of this compound has been linked to its ability to methylate DNA and form covalent bonds with amino groups on proteins.Formula:C12H13NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:171.24 g/molRef: 3D-FE38728
Discontinued product