
CAS 1185-11-1: difluoro(dinitro)methane
Formula:CF2N2O4
InChI:InChI=1/CF2N2O4/c2-1(3,4(6)7)5(8)9
SMILES:C(F)(F)(N(=O)=O)N(=O)=O
Synonyms:- Difluorodinitromethane
- Methane, Difluorodinitro-
- Difluoro(dinitro)methane
Sort by
Found 1 products.
Difluoro-Dinitromethane
CAS:Difluoro-Dinitromethane (DFDM) is a colorless, crystalline solid that is soluble in aromatic solvents. It has been shown to be an effective solvent for the fluorination of chloro-substituted aromatic compounds. DFDM can also be used as a nucleophile in nitro-substitution reactions. The shift of the frequency of the DFDM molecule from 0.5 to 1.5 GHz is due to a change in the electron distribution between electrons and orbitals. This shift can be used to calculate the parameters for this molecule and its reaction with other molecules or solutes.Formula:CF2N2O4Purity:Min. 95%Molecular weight:142.02 g/mol