
CAS 1187951-06-9: (2S,4aS,6aR,7R,9R,10aS,10bS)-2-(3-Furanyl)dodecahydro-6a,9-dihydroxy-10b-methyl-4,6-dioxo-2H-naphtho[2,1-c]pyran-7-carboxylic acid
Formula:C19H22O8
InChI:InChI=1S/C19H22O8/c1-18-7-13(9-2-3-26-8-9)27-17(24)12(18)6-15(21)19(25)11(16(22)23)4-10(20)5-14(18)19/h2-3,8,10-14,20,25H,4-7H2,1H3,(H,22,23)/t10-,11-,12+,13-,14-,18+,19-/m0/s1
InChI key:InChIKey=VFBSFVHKKKXNHM-JFQAYLLPSA-N
SMILES:O[C@@]12[C@]([C@@]3(C)[C@](CC1=O)(C(=O)O[C@@H](C3)C=4C=COC4)[H])(C[C@@H](O)C[C@H]2C(O)=O)[H]
Synonyms:- (2S,4aS,6aR,7R,9R,10aS,10bS)-2-(3-Furanyl)dodecahydro-6a,9-dihydroxy-10b-methyl-4,6-dioxo-2H-naphtho[2,1-c]pyran-7-carboxylic acid
- 2H-Naphtho[2,1-c]pyran-7-carboxylic acid, 2-(3-furanyl)dodecahydro-6a,9-dihydroxy-10b-methyl-4,6-dioxo-, (2S,4aS,6aR,7R,9R,10aS,10bS)-
- Diosbulbin J
- DiosbulbinJ
Sort by
Found 4 products.
Diosbulbin J
CAS:Diosbulbin J is a natural diterpenoid compound, which is isolated from the tubers of certain Dioscorea species. This product is derived from a natural source, specifically the Dioscorea plants, known for their diverse phytochemical constituents. Diosbulbin J exhibits its mode of action through the induction of oxidative stress and interaction with cellular macromolecules, potentially leading to cytotoxic effects. Research indicates that it may modulate various biochemical pathways, contributing to its bioactive properties. Diosbulbin J is primarily researched for its potential applications in the field of pharmacology, particularly in anticancer strategies. Its ability to induce cell death in cancerous cells highlights its significance as a candidate for drug development. Additionally, it serves as a useful compound for studying the mechanisms of natural product-based cytotoxicity and exploring novel therapeutic targets. Given its bioactivity, Diosbulbin J continues to be of significant interest in the scientific community for its potential therapeutic applications and as a tool for better understanding complex biological interactions.Formula:C19H22O8Purity:Min. 95%Molecular weight:378.4 g/molDiosbulbin J
CAS:Diosbulbin J is a natural product for research related to life sciences. The catalog number is TN3873 and the CAS number is 1187951-06-9.Formula:C19H22O8Purity:98%Color and Shape:SolidMolecular weight:378.37