CAS 1201-24-7: 5-Methyl-1H-indazole-3-carboxylic acid
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-5-2-3-7-6(4-5)8(9(12)13)11-10-7/h2-4H,1H3,(H,10,11)(H,12,13)
SMILES:Cc1ccc2c(c1)c(C(=O)O)n[nH]2
Synonyms:- Chembrdg-Bb 4006004
- 5-Methyl-3-(1H)Indazole Carboxylic Acid
- 5-methyl-1H-indazole-3-carboxy
- 5-Methylindazole-3-Carboxylic Acid
Sort by
Found 4 products.
5-Methyl-1H-indazole-3-carboxylic acid
CAS:5-Methyl-1H-indazole-3-carboxylic acidPurity:99%Molecular weight:176.17g/mol5-Methyl-1H-indazole-3-carboxylic acid
CAS:5-Methyl-1H-indazole-3-carboxylic acid is an indazole derivative which has been shown to inhibit the growth of cancer cells in vitro. The compound binds to a specific site on the ATP binding cassette subfamily B member 1 (ABCB1) protein and thereby blocks the efflux of anticancer drugs from the cells, leading to their accumulation. This results in increased cytotoxicity and inhibits tumor growth.Formula:C9H8N2O2Purity:Min. 95%Molecular weight:176.17 g/mol1H-Indazole-3-carboxylic acid, 5-methyl-
CAS:Formula:C9H8N2O2Purity:95%Color and Shape:SolidMolecular weight:176.1725-Methyl-1H-indazole-3-carboxylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:176.1750030517578
