
CAS 123155-06-6: Octakis(6-O-tert-butyldimethylsilyl)-γ-cyclodextrin
Formula:C96H192O40Si8
InChI:InChI=1S/C96H192O40Si8/c1-89(2,3)137(25,26)113-41-49-73-57(97)65(105)81(121-49)130-74-50(42-114-138(27,28)90(4,5)6)123-83(67(107)59(74)99)132-76-52(44-116-140(31,32)92(10,11)12)125-85(69(109)61(76)101)134-78-54(46-118-142(35,36)94(16,17)18)127-87(71(111)63(78)103)136-80-56(48-120-144(39,40)96(22,23)24)128-88(72(112)64(80)104)135-79-55(47-119-143(37,38)95(19,20)21)126-86(70(110)62(79)102)133-77-53(45-117-141(33,34)93(13,14)15)124-84(68(108)60(77)100)131-75-51(43-115-139(29,30)91(7,8)9)122-82(129-73)66(106)58(75)98/h49-88,97-112H,41-48H2,1-40H3/t49-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,84-,85-,86-,87-,88-/m1/s1
InChI key:InChIKey=MKSDSPVSZRMRNY-YKBAZCJNSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)[C@@H]1[C@]2(O[C@]3(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@]([C@H](O)[C@H]3O)(O[C@]4(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@]([C@H](O)[C@H]4O)(O[C@]5(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@]([C@H](O)[C@H]5O)(O[C@]6(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@]7(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@]8(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@]9(O[C@H](CO[Si](C(C)(C)C)(C)C)[C@@](O[C@@](O1)([C@H](O)[C@H]2O)[H])([C@H](O)[C@H]9O)[H])[H])([C@H](O)[C@H]8O)[H])[H])([C@H](O)[C@H]7O)[H])[H])([C@H](O)[C@H]6O)[H])[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- Octa-(6-oxy-tert-butyl-dimethylsilyl)-γ-cyclodextrin
- Octakis(6-O-tert-butyldimethylsilyl)-γ-cyclodextrin
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34,37,39-Hexadecaoxanonacyclo[36.2.2.23,6.28,11.213,16.218,21.223,26.228,31.233,36]hexapentacontane, γ-cyclodextrin deriv.
- γ-Cyclodextrin, 6A,6B,6C,6D,6E,6F,6G,6H-octakis-O-[(1,1-dimethylethyl)dimethylsilyl]-
- 6A,6B,6C,6D,6E,6F,6G,6H-Octakis-O-[(1,1-dimethylethyl)dimethylsilyl]-γ-cyclodextrin
Sort by
Found 1 products.
6-O-tert-butyldimethylsilyl-γ-cyclodextrin
CAS:This gamma-cyclodextrin (γ-CD) derivative is a modified cyclic oligosaccharide composed of eight glucose units, featuring a larger cavity size than α- and β-cyclodextrins. This structural characteristic allows γ-CDs to form inclusion complexes with a wider range of guest molecules, making it particularly versatile in various industries. In the food sector, it is used as a carrier and stabilizer for flavors, fat-soluble vitamins, and polyunsaturated fatty acids, protecting volatile compounds from evaporation. In pharmaceuticals, it enhances the solubility and bioavailability of poorly water-soluble drugs and, thanks to its larger ring size, allows for the encapsulation of larger molecules or even entire drug molecules. γ-CDs and derivatives are also used for environmental remediation and, in analytical chemistry, for the extraction and concentration of target substances.Formula:C96H192O40Si8Purity:Min. 95%Molecular weight:2,211.21 g/mol