
CAS 123483-19-2: 3-O-Caffeoylquinic acid methyl ester
Formula:C17H20O9
InChI:InChI=1S/C17H20O9/c1-25-16(23)17(24)7-12(20)15(22)13(8-17)26-14(21)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-20,22,24H,7-8H2,1H3/b5-3+/t12-,13-,15-,17+/m1/s1
InChI key:InChIKey=MZNIJRAPCCELQX-AWOKGZDASA-N
SMILES:C(OC)(=O)[C@@]1(O)C[C@@H](OC(/C=C/C2=CC(O)=C(O)C=C2)=O)[C@H](O)[C@H](O)C1
Synonyms:- 3-O-Caffeoylquinic acid methyl ester
- Cyclohexanecarboxylic acid, 3-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxy-, methyl ester, (1S,3R,4R,5R)-
- (E)-Chlorogenic acid methyl ester
- Cyclohexanecarboxylic acid, 3-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,4,5-trihydroxy-, methyl ester, [1S-[1α,3β(E),4α,5α]]-
- Cyclohexanecarboxylic acid, 3-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4,5-trihydroxy-, methyl ester, (1S,3R,4R,5R)-
Sort by
Found 8 products.
3-O-Caffeoylquinic acid methyl ester
CAS:3-O-Caffeoylquinic acid methyl esterPurity:≥98%Molecular weight:368.34g/molChlorogenic acid methylester
CAS:Chlorogenic acid methylester analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C17H20O9Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:368.343-O-Caffeoylquinic acid methyl ester
CAS:3-O-Caffeoylquinic acid methyl ester is a natural product from Morus alba L.Formula:C17H20O9Purity:99.57%Color and Shape:SolidMolecular weight:368.343-O-Caffeoylquinic acid methyl ester
CAS:3-O-Caffeoylquinic acid methyl ester is a methyl ester derivative of chlorogenic acid, which is a polyphenolic compound commonly found in various plant species. This esterification enhances its solubility and stability compared to the parent compound. The compound is typically derived from natural sources such as coffee beans, artichokes, and various other fruits and vegetables. The mode of action of 3-O-Caffeoylquinic acid methyl ester involves its role as an antioxidant, where it neutralizes free radicals and reduces oxidative stress. This property is attributed to the presence of the caffeoyl group, which can donate hydrogen to stabilize radical species, thereby mitigating potential damage to biomolecules such as DNA, lipids, and proteins. The compound's uses and applications are diverse, encompassing fields such as pharmaceuticals, nutraceuticals, and food chemistry. In pharmaceutics, it is of interest for its potential anti-inflammatory and neuroprotective effects. In nutraceuticals, its antioxidant capacity finds application in dietary supplements aimed at promoting health and longevity. In food science, it may be utilized as a natural preservative to enhance the shelf life and stability of food products by minimizing oxidation.Formula:C16H18O9CH2Purity:Min. 95%Molecular weight:368.34 g/mol3-O-Caffeoylquinic Acid Methyl Ester
CAS:Controlled ProductFormula:C17H20O9Color and Shape:NeatMolecular weight:368.335